C19H21N3O2S — CID 166413666
N-methyl-N-[4-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 166413666) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-methyl-N-[4-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-methyl-N-[4-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166413666 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-methyl-N-[4-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CCC[C@@H]2c2csc(C)n2)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-4-18(23)21(3)15-9-7-14(8-10-15)19(24)22-11-5-6-17(22)16-12-25-13(2)20-16/h4,7-10,12,17H,1,5-6,11H2,2-3H3/t17-/m1/s1 |
| InChIKey | SFEUBASZYIDTKY-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|