C17H20F2N2O3 — CID 166413995
N-[4-[3-(difluoromethoxy)piperidine-1-carbonyl]phenyl]-N-methylprop-2-enamide (PubChem CID 166413995) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is N-[4-[3-(difluoromethoxy)piperidine-1-carbonyl]phenyl]-N-methylprop-2-enamide.
| Compound Name | N-[4-[3-(difluoromethoxy)piperidine-1-carbonyl]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166413995 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[4-[3-(difluoromethoxy)piperidine-1-carbonyl]phenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CCCC(OC(F)F)C2)cc1 |
| InChI | InChI=1S/C17H20F2N2O3/c1-3-15(22)20(2)13-8-6-12(7-9-13)16(23)21-10-4-5-14(11-21)24-17(18)19/h3,6-9,14,17H,1,4-5,10-11H2,2H3 |
| InChIKey | UNLFSCPPVIRHNQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|