C21H19F3N2O2 — CID 166414223
N-methyl-N-[4-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]prop-2-enamide (PubChem CID 166414223) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is N-methyl-N-[4-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-methyl-N-[4-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166414223 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-methyl-N-[4-[8-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CCc3cccc(C(F)(F)F)c3C2)cc1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-3-19(27)25(2)16-9-7-15(8-10-16)20(28)26-12-11-14-5-4-6-18(17(14)13-26)21(22,23)24/h3-10H,1,11-13H2,2H3 |
| InChIKey | DCQFNAZHVHILNI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|