About N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide
N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide (PubChem CID 166416087) has the molecular formula C18H21F3N2O3
and a molecular weight of 370.37 g/mol. Its IUPAC name is N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide |
| PubChem CID | 166416087 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CCOCC2CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N2O3/c1-3-16(24)22(2)14-6-4-13(5-7-14)17(25)23-10-11-26-12-15(23)8-9-18(19,20)21/h3-7,15H,1,8-12H2,2H3 |
| InChIKey | CYALABSGKTTXDJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide?
The IUPAC name of N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide (CID 166416087) is N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide.
What is the SMILES notation for N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide?
The canonical SMILES for N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide is C=CC(=O)N(C)c1ccc(C(=O)N2CCOCC2CCC(F)(F)F)cc1.
What is the InChIKey of N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide?
The InChIKey is CYALABSGKTTXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F3N2O3/c1-3-16(24)22(2)14-6-4-13(5-7-14)17(25)23-10-11-26-12-15(23)8-9-18(19,20)21/h3-7,15H,1,8-12H2,2H3.
What are the key properties of N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide?
N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide has a molecular weight of 370.37 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[4-[3-(3,3,3-trifluoropropyl)morpholine-4-carbonyl]phenyl]prop-2-enamide is sourced from PubChem (CID 166416087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).