C19H26N2O4 — CID 167918351
N-[4-[6-(2-hydroxyethyl)-2,2-dimethylmorpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide (PubChem CID 167918351) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[4-[6-(2-hydroxyethyl)-2,2-dimethylmorpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide.
| Compound Name | N-[4-[6-(2-hydroxyethyl)-2,2-dimethylmorpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 167918351 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[4-[6-(2-hydroxyethyl)-2,2-dimethylmorpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CC(CCO)OC(C)(C)C2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-5-17(23)20(4)15-8-6-14(7-9-15)18(24)21-12-16(10-11-22)25-19(2,3)13-21/h5-9,16,22H,1,10-13H2,2-4H3 |
| InChIKey | PYCHYYFVWDHREP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|