C18H20N4O3 — CID 166414086
N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide (PubChem CID 166414086) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide.
| Compound Name | N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide |
|---|---|
| PubChem CID | 166414086 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)NCc2c(C)c(C)n[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H20N4O3/c1-5-16(23)22(4)14-8-6-13(7-9-14)17(24)19-10-15-11(2)12(3)20-21-18(15)25/h5-9H,1,10H2,2-4H3,(H,19,24)(H,21,25) |
| InChIKey | IRYJYEKXHMNEOV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|