C19H21N3O3 — CID 166414201
N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide (PubChem CID 166414201) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide.
| Compound Name | N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide |
|---|---|
| PubChem CID | 166414201 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-4-[methyl(prop-2-enoyl)amino]benzamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)NCc2ccc(C)n(C)c2=O)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-5-17(23)22(4)16-10-8-14(9-11-16)18(24)20-12-15-7-6-13(2)21(3)19(15)25/h5-11H,1,12H2,2-4H3,(H,20,24) |
| InChIKey | FLDSRESCLQBFKW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|