C18H20N4O2 — CID 166415580
N-[(2-methylpyrazol-3-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide (PubChem CID 166415580) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(2-methylpyrazol-3-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide.
| Compound Name | N-[(2-methylpyrazol-3-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166415580 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[(2-methylpyrazol-3-yl)methyl]-N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1ccnn1C)c1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C18H20N4O2/c1-3-18(24)22(12-15-9-10-19-21(15)2)14-7-8-16-13(11-14)5-4-6-17(23)20-16/h3,7-11H,1,4-6,12H2,2H3,(H,20,23) |
| InChIKey | CIPMSAKFTTYPND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|