C16H27N3O2 — CID 166415899
N-[2-[3-(3,3-dimethylazetidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 166415899) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[2-[3-(3,3-dimethylazetidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | N-[2-[3-(3,3-dimethylazetidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 166415899 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-[2-[3-(3,3-dimethylazetidin-1-yl)pyrrolidin-1-yl]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1CCC(N2CC(C)(C)C2)C1 |
| InChI | InChI=1S/C16H27N3O2/c1-5-14(20)17(6-2)10-15(21)18-8-7-13(9-18)19-11-16(3,4)12-19/h5,13H,1,6-12H2,2-4H3 |
| InChIKey | GSQXAOHTWNSLPV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|