C17H26N2O2 — CID 154796291
N-ethyl-N-[2-[(1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 154796291) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-ethyl-N-[2-[(1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-ethyl-N-[2-[(1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 154796291 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N-ethyl-N-[2-[(1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1C[C@@H]2[C@@H]3CC[C@@H](C3)[C@]2(C)C1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-15(20)18(5-2)10-16(21)19-9-14-12-6-7-13(8-12)17(14,3)11-19/h4,12-14H,1,5-11H2,2-3H3/t12-,13+,14-,17+/m1/s1 |
| InChIKey | VZBYOIVHNMRPGO-OEUWWYETSA-N |
| XLogP | 1.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|