C14H21N3O3 — CID 166407965
N-ethyl-N-[2-oxo-2-(9-oxo-4,8-diazaspiro[2.6]nonan-4-yl)ethyl]prop-2-enamide (PubChem CID 166407965) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-ethyl-N-[2-oxo-2-(9-oxo-4,8-diazaspiro[2.6]nonan-4-yl)ethyl]prop-2-enamide.
| Compound Name | N-ethyl-N-[2-oxo-2-(9-oxo-4,8-diazaspiro[2.6]nonan-4-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407965 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-ethyl-N-[2-oxo-2-(9-oxo-4,8-diazaspiro[2.6]nonan-4-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1CCCNC(=O)C12CC2 |
| InChI | InChI=1S/C14H21N3O3/c1-3-11(18)16(4-2)10-12(19)17-9-5-8-15-13(20)14(17)6-7-14/h3H,1,4-10H2,2H3,(H,15,20) |
| InChIKey | MPAMVGUAPPWYSQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|