C17H22N2O2 — CID 162629640
1-(2-ethylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 162629640) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-(2-ethylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 1-(2-ethylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 162629640 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(2-ethylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | CCc1ccccc1C(=O)N1CCCC12CCCNC2=O |
| InChI | InChI=1S/C17H22N2O2/c1-2-13-7-3-4-8-14(13)15(20)19-12-6-10-17(19)9-5-11-18-16(17)21/h3-4,7-8H,2,5-6,9-12H2,1H3,(H,18,21) |
| InChIKey | DPQIEDBYDGULNV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |