C14H15FN2O2 — CID 20781160
1-(4-fluorobenzoyl)-1,7-diazaspiro[4.4]nonan-6-one (PubChem CID 20781160) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-1,7-diazaspiro[4.4]nonan-6-one.
| Compound Name | 1-(4-fluorobenzoyl)-1,7-diazaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 20781160 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(4-fluorobenzoyl)-1,7-diazaspiro[4.4]nonan-6-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC12CCNC2=O |
| InChI | InChI=1S/C14H15FN2O2/c15-11-4-2-10(3-5-11)12(18)17-9-1-6-14(17)7-8-16-13(14)19/h2-5H,1,6-9H2,(H,16,19) |
| InChIKey | VAWULOKZCKLDHW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |