C16H18F2N2O2 — CID 162629447
1-(3,5-difluorobenzoyl)-9-methyl-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 162629447) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-(3,5-difluorobenzoyl)-9-methyl-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 1-(3,5-difluorobenzoyl)-9-methyl-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 162629447 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(3,5-difluorobenzoyl)-9-methyl-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | CN1CCCC2(CCCN2C(=O)c2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C16H18F2N2O2/c1-19-6-2-4-16(15(19)22)5-3-7-20(16)14(21)11-8-12(17)10-13(18)9-11/h8-10H,2-7H2,1H3 |
| InChIKey | PXIKZSXMUVGWIE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |