C22H24N2O2 — CID 162635147
9-methyl-1-(4-phenylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 162635147) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 9-methyl-1-(4-phenylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 9-methyl-1-(4-phenylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 162635147 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 9-methyl-1-(4-phenylbenzoyl)-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | CN1CCCC2(CCCN2C(=O)c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C22H24N2O2/c1-23-15-5-13-22(21(23)26)14-6-16-24(22)20(25)19-11-9-18(10-12-19)17-7-3-2-4-8-17/h2-4,7-12H,5-6,13-16H2,1H3 |
| InChIKey | LPJMYTJQRDMXIN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |