C17H23N3O5 — CID 166598201
formic acid;9-methyl-1-[2-(2-oxo-1-pyridinyl)acetyl]-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 166598201) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is formic acid;9-methyl-1-[2-(2-oxo-1-pyridinyl)acetyl]-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | formic acid;9-methyl-1-[2-(2-oxo-1-pyridinyl)acetyl]-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 166598201 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | formic acid;9-methyl-1-[2-(2-oxo-1-pyridinyl)acetyl]-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | CN1CCCC2(CCCN2C(=O)Cn2ccccc2=O)C1=O.O=CO |
| InChI | InChI=1S/C16H21N3O3.CH2O2/c1-17-9-4-7-16(15(17)22)8-5-11-19(16)14(21)12-18-10-3-2-6-13(18)20;2-1-3/h2-3,6,10H,4-5,7-9,11-12H2,1H3;1H,(H,2,3) |
| InChIKey | CGGISAHEDJZWBC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|