C19H22F2N2O3 — CID 166417269
1-[4-[5-(difluoromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166417269) has the molecular formula C19H22F2N2O3 and a molecular weight of 364.39 g/mol. Its IUPAC name is 1-[4-[5-(difluoromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-(difluoromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166417269 |
| Molecular Formula | C19H22F2N2O3 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-[4-[5-(difluoromethyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2CCOc3ccccc3C2C(F)F)CC1 |
| InChI | InChI=1S/C19H22F2N2O3/c1-2-16(24)22-9-7-13(8-10-22)19(25)23-11-12-26-15-6-4-3-5-14(15)17(23)18(20)21/h2-6,13,17-18H,1,7-12H2 |
| InChIKey | FDRVHQPGBAZQIA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|