C20H24N4O3 — CID 166417741
3-(3-but-3-ynyldiazirin-3-yl)-N-[[3-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]methyl]propanamide (PubChem CID 166417741) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[[3-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]methyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[[3-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 166417741 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[[3-[2-(cyclopropylamino)-2-oxoethoxy]phenyl]methyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NCc2cccc(OCC(=O)NC3CC3)c2)N=N1 |
| InChI | InChI=1S/C20H24N4O3/c1-2-3-10-20(23-24-20)11-9-18(25)21-13-15-5-4-6-17(12-15)27-14-19(26)22-16-7-8-16/h1,4-6,12,16H,3,7-11,13-14H2,(H,21,25)(H,22,26) |
| InChIKey | MZZAFBRNKWRYGR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|