C15H17ClFNO3 — CID 166418424
N-[(3-chloro-2-fluorophenyl)methyl]-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide (PubChem CID 166418424) has the molecular formula C15H17ClFNO3 and a molecular weight of 313.76 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 166418424 |
| Molecular Formula | C15H17ClFNO3 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-N-(1,4-dioxan-2-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cccc(Cl)c1F)CC1COCCO1 |
| InChI | InChI=1S/C15H17ClFNO3/c1-2-14(19)18(9-12-10-20-6-7-21-12)8-11-4-3-5-13(16)15(11)17/h2-5,12H,1,6-10H2 |
| InChIKey | WTJAAJZIEZIMQQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|