C21H25N5O2 — CID 166418698
N-[(1-cyclobutyltriazol-4-yl)methyl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 166418698) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(1-cyclobutyltriazol-4-yl)methyl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | N-[(1-cyclobutyltriazol-4-yl)methyl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166418698 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[(1-cyclobutyltriazol-4-yl)methyl]-N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cn(C2CCC2)nn1)c1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-2-20(27)25(14-17-15-26(23-22-17)19-6-5-7-19)18-10-8-16(9-11-18)21(28)24-12-3-4-13-24/h2,8-11,15,19H,1,3-7,12-14H2 |
| InChIKey | HVAWEGQRSGVGPJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|