C21H25N3O3S — CID 166418745
N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-[4-(4-hydroxypiperidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 166418745) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-[4-(4-hydroxypiperidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-[4-(4-hydroxypiperidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166418745 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-4-yl)methyl]-N-[4-(4-hydroxypiperidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1csc(CC)n1)c1ccc(C(=O)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O3S/c1-3-19-22-16(14-28-19)13-24(20(26)4-2)17-7-5-15(6-8-17)21(27)23-11-9-18(25)10-12-23/h4-8,14,18,25H,2-3,9-13H2,1H3 |
| InChIKey | MQNJWVWSOZVPGR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|