C17H20N2O4 — CID 166419511
N-[4-[3-ethenyl-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]prop-2-enamide (PubChem CID 166419511) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[4-[3-ethenyl-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-ethenyl-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166419511 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[4-[3-ethenyl-3-(hydroxymethyl)morpholine-4-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCOCC2(C=C)CO)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-3-15(21)18-14-7-5-13(6-8-14)16(22)19-9-10-23-12-17(19,4-2)11-20/h3-8,20H,1-2,9-12H2,(H,18,21) |
| InChIKey | ZRIATKLJEMPHQL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|