About N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide
N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 166411726) has the molecular formula C15H13BrN4O2
and a molecular weight of 361.20 g/mol. Its IUPAC name is N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide |
| PubChem CID | 166411726 |
| Molecular Formula | C15H13BrN4O2 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCn3ncc(Br)c32)cc1 |
| InChI | InChI=1S/C15H13BrN4O2/c1-2-13(21)18-11-5-3-10(4-6-11)15(22)19-7-8-20-14(19)12(16)9-17-20/h2-6,9H,1,7-8H2,(H,18,21) |
| InChIKey | URFRRIZCJURXHB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide?
The IUPAC name of N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide (CID 166411726) is N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide.
What is the SMILES notation for N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide?
The canonical SMILES for N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide is C=CC(=O)Nc1ccc(C(=O)N2CCn3ncc(Br)c32)cc1.
What is the InChIKey of N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide?
The InChIKey is URFRRIZCJURXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN4O2/c1-2-13(21)18-11-5-3-10(4-6-11)15(22)19-7-8-20-14(19)12(16)9-17-20/h2-6,9H,1,7-8H2,(H,18,21).
What are the key properties of N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide?
N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide has a molecular weight of 361.20 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(7-bromo-2,3-dihydroimidazo[2,1-e]pyrazole-1-carbonyl)phenyl]prop-2-enamide is sourced from PubChem (CID 166411726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).