C13H12F3NO2 — CID 166419773
N-[(1R,2S)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-2-fluoroprop-2-enamide (PubChem CID 166419773) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is N-[(1R,2S)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[(1R,2S)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 166419773 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[(1R,2S)-2-[2-(difluoromethoxy)phenyl]cyclopropyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)N[C@@H]1C[C@H]1c1ccccc1OC(F)F |
| InChI | InChI=1S/C13H12F3NO2/c1-7(14)12(18)17-10-6-9(10)8-4-2-3-5-11(8)19-13(15)16/h2-5,9-10,13H,1,6H2,(H,17,18)/t9-,10+/m0/s1 |
| InChIKey | VDNRUENUAWOJBX-VHSXEESVSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|