C18H24FNO3 — CID 166419864
tert-butyl (2S)-2-[(2-fluoro-3-methylphenyl)methyl-prop-2-enoylamino]propanoate (PubChem CID 166419864) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-fluoro-3-methylphenyl)methyl-prop-2-enoylamino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2-fluoro-3-methylphenyl)methyl-prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 166419864 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl (2S)-2-[(2-fluoro-3-methylphenyl)methyl-prop-2-enoylamino]propanoate |
| SMILES | C=CC(=O)N(Cc1cccc(C)c1F)[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FNO3/c1-7-15(21)20(13(3)17(22)23-18(4,5)6)11-14-10-8-9-12(2)16(14)19/h7-10,13H,1,11H2,2-6H3/t13-/m0/s1 |
| InChIKey | UQMXNAGZAQPMIF-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|