C14H24N2O4 — CID 126831691
tert-butyl 2-[2-acetamidoethyl(prop-2-enoyl)amino]propanoate (PubChem CID 126831691) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl 2-[2-acetamidoethyl(prop-2-enoyl)amino]propanoate.
| Compound Name | tert-butyl 2-[2-acetamidoethyl(prop-2-enoyl)amino]propanoate |
|---|---|
| PubChem CID | 126831691 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | tert-butyl 2-[2-acetamidoethyl(prop-2-enoyl)amino]propanoate |
| SMILES | C=CC(=O)N(CCNC(C)=O)C(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-7-12(18)16(9-8-15-11(3)17)10(2)13(19)20-14(4,5)6/h7,10H,1,8-9H2,2-6H3,(H,15,17) |
| InChIKey | VBJVUXMZYVKELD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|