C18H24N2O4 — CID 166420246
N-[4-[2-[(4-methoxyoxan-4-yl)methylamino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166420246) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[4-[2-[(4-methoxyoxan-4-yl)methylamino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[(4-methoxyoxan-4-yl)methylamino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166420246 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[4-[2-[(4-methoxyoxan-4-yl)methylamino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)NCC2(OC)CCOCC2)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-3-16(21)20-15-6-4-14(5-7-15)12-17(22)19-13-18(23-2)8-10-24-11-9-18/h3-7H,1,8-13H2,2H3,(H,19,22)(H,20,21) |
| InChIKey | AYZIXNVYUFHZRT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|