C20H16ClN3O2S — CID 166420521
N-[4-(4-chloro-2-cyanophenyl)sulfanylphenyl]-1-prop-2-enoylazetidine-3-carboxamide (PubChem CID 166420521) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is N-[4-(4-chloro-2-cyanophenyl)sulfanylphenyl]-1-prop-2-enoylazetidine-3-carboxamide.
| Compound Name | N-[4-(4-chloro-2-cyanophenyl)sulfanylphenyl]-1-prop-2-enoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 166420521 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[4-(4-chloro-2-cyanophenyl)sulfanylphenyl]-1-prop-2-enoylazetidine-3-carboxamide |
| SMILES | C=CC(=O)N1CC(C(=O)Nc2ccc(Sc3ccc(Cl)cc3C#N)cc2)C1 |
| InChI | InChI=1S/C20H16ClN3O2S/c1-2-19(25)24-11-14(12-24)20(26)23-16-4-6-17(7-5-16)27-18-8-3-15(21)9-13(18)10-22/h2-9,14H,1,11-12H2,(H,23,26) |
| InChIKey | DJHRFBMYWOMJOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|