C16H19FN2O4S — CID 166413075
N-(4-fluoro-3-methylsulfonylphenyl)-1-prop-2-enoylpiperidine-3-carboxamide (PubChem CID 166413075) has the molecular formula C16H19FN2O4S and a molecular weight of 354.40 g/mol. Its IUPAC name is N-(4-fluoro-3-methylsulfonylphenyl)-1-prop-2-enoylpiperidine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-methylsulfonylphenyl)-1-prop-2-enoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 166413075 |
| Molecular Formula | C16H19FN2O4S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(4-fluoro-3-methylsulfonylphenyl)-1-prop-2-enoylpiperidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(C(=O)Nc2ccc(F)c(S(C)(=O)=O)c2)C1 |
| InChI | InChI=1S/C16H19FN2O4S/c1-3-15(20)19-8-4-5-11(10-19)16(21)18-12-6-7-13(17)14(9-12)24(2,22)23/h3,6-7,9,11H,1,4-5,8,10H2,2H3,(H,18,21) |
| InChIKey | UMRLOGOCJVQYTK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|