C20H24N4O5 — CID 166420525
N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-1-prop-2-enoylazetidine-3-carboxamide (PubChem CID 166420525) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-1-prop-2-enoylazetidine-3-carboxamide.
| Compound Name | N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-1-prop-2-enoylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 166420525 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-N-ethyl-1-prop-2-enoylazetidine-3-carboxamide |
| SMILES | C=CC(=O)N1CC(C(=O)N(CC)Cc2nc3cc(OC)c(OC)cc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C20H24N4O5/c1-5-18(25)24-9-12(10-24)20(27)23(6-2)11-17-21-14-8-16(29-4)15(28-3)7-13(14)19(26)22-17/h5,7-8,12H,1,6,9-11H2,2-4H3,(H,21,22,26) |
| InChIKey | HXTSYIRABRSAEP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|