C20H19FN2O3 — CID 166420649
N-(4-cyclobutyloxy-3-fluorophenyl)-2-(prop-2-enoylamino)benzamide (PubChem CID 166420649) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is N-(4-cyclobutyloxy-3-fluorophenyl)-2-(prop-2-enoylamino)benzamide.
| Compound Name | N-(4-cyclobutyloxy-3-fluorophenyl)-2-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166420649 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(4-cyclobutyloxy-3-fluorophenyl)-2-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccccc1C(=O)Nc1ccc(OC2CCC2)c(F)c1 |
| InChI | InChI=1S/C20H19FN2O3/c1-2-19(24)23-17-9-4-3-8-15(17)20(25)22-13-10-11-18(16(21)12-13)26-14-6-5-7-14/h2-4,8-12,14H,1,5-7H2,(H,22,25)(H,23,24) |
| InChIKey | MYVFNKKEPNZTNA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|