C17H18N4O2 — CID 166420877
N-[2-[2-oxo-2-[(1-prop-2-enylpyrazol-4-yl)amino]ethyl]phenyl]prop-2-enamide (PubChem CID 166420877) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-[2-[2-oxo-2-[(1-prop-2-enylpyrazol-4-yl)amino]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-oxo-2-[(1-prop-2-enylpyrazol-4-yl)amino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166420877 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[2-[2-oxo-2-[(1-prop-2-enylpyrazol-4-yl)amino]ethyl]phenyl]prop-2-enamide |
| SMILES | C=CCn1cc(NC(=O)Cc2ccccc2NC(=O)C=C)cn1 |
| InChI | InChI=1S/C17H18N4O2/c1-3-9-21-12-14(11-18-21)19-17(23)10-13-7-5-6-8-15(13)20-16(22)4-2/h3-8,11-12H,1-2,9-10H2,(H,19,23)(H,20,22) |
| InChIKey | CNXZQGRPEISALW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|