C19H21N3O4S — CID 167992796
N-[2-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]phenyl]prop-2-enamide (PubChem CID 167992796) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[2-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167992796 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[2-[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1CC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-2-18(23)22-17-6-4-3-5-15(17)13-19(24)21-12-11-14-7-9-16(10-8-14)27(20,25)26/h2-10H,1,11-13H2,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | MOGAXJZXVTWNSQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|