C21H20N4O3 — CID 166420665
N-[2-[2-oxo-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]ethyl]phenyl]prop-2-enamide (PubChem CID 166420665) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is N-[2-[2-oxo-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-oxo-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166420665 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[2-[2-oxo-2-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylamino]ethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1CC(=O)NCCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H20N4O3/c1-2-18(26)23-17-11-7-6-10-16(17)14-19(27)22-13-12-20-24-25-21(28-20)15-8-4-3-5-9-15/h2-11H,1,12-14H2,(H,22,27)(H,23,26) |
| InChIKey | MJWNZMOCEZVGHE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|