C21H22F3N3O2S — CID 166420890
1-[3-[4-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidine-1-carbonyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 166420890) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is 1-[3-[4-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidine-1-carbonyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidine-1-carbonyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166420890 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-[3-[4-[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]piperidine-1-carbonyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2CCC(c3nc4cc(C(F)(F)F)ccc4s3)CC2)C1 |
| InChI | InChI=1S/C21H22F3N3O2S/c1-2-18(28)27-10-7-14(12-27)20(29)26-8-5-13(6-9-26)19-25-16-11-15(21(22,23)24)3-4-17(16)30-19/h2-4,11,13-14H,1,5-10,12H2 |
| InChIKey | RDKLZFWFISSOOM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|