C20H23N3O2S — CID 166421480
1-[3-[2-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 166421480) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[3-[2-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166421480 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[3-[2-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(CC(=O)N2CCCCC2c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C20H23N3O2S/c1-2-18(24)22-12-14(13-22)11-19(25)23-10-6-5-8-16(23)20-21-15-7-3-4-9-17(15)26-20/h2-4,7,9,14,16H,1,5-6,8,10-13H2 |
| InChIKey | JELIHJMGBMQSFK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|