C20H25BrN2O2S — CID 166421492
N-[(3-bromophenyl)methyl]-2-(1-prop-2-enoylazetidin-3-yl)-N-(thian-4-yl)acetamide (PubChem CID 166421492) has the molecular formula C20H25BrN2O2S and a molecular weight of 437.40 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-(1-prop-2-enoylazetidin-3-yl)-N-(thian-4-yl)acetamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2-(1-prop-2-enoylazetidin-3-yl)-N-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 166421492 |
| Molecular Formula | C20H25BrN2O2S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-(1-prop-2-enoylazetidin-3-yl)-N-(thian-4-yl)acetamide |
| SMILES | C=CC(=O)N1CC(CC(=O)N(Cc2cccc(Br)c2)C2CCSCC2)C1 |
| InChI | InChI=1S/C20H25BrN2O2S/c1-2-19(24)22-12-16(13-22)11-20(25)23(18-6-8-26-9-7-18)14-15-4-3-5-17(21)10-15/h2-5,10,16,18H,1,6-9,11-14H2 |
| InChIKey | ITJOAOFYUHPLLB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|