C16H18BrNO2 — CID 171509384
1-[4-[2-(3-bromophenyl)acetyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 171509384) has the molecular formula C16H18BrNO2 and a molecular weight of 336.23 g/mol. Its IUPAC name is 1-[4-[2-(3-bromophenyl)acetyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-(3-bromophenyl)acetyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171509384 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[4-[2-(3-bromophenyl)acetyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H18BrNO2/c1-2-16(20)18-8-6-13(7-9-18)15(19)11-12-4-3-5-14(17)10-12/h2-5,10,13H,1,6-9,11H2 |
| InChIKey | ZTGLHEOVNHBSGN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|