C22H21BrN2O2 — CID 166421536
N-[3-[2-[4-(3-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166421536) has the molecular formula C22H21BrN2O2 and a molecular weight of 425.33 g/mol. Its IUPAC name is N-[3-[2-[4-(3-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-(3-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421536 |
| Molecular Formula | C22H21BrN2O2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[3-[2-[4-(3-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CC(=O)N2CC=C(c3cccc(Br)c3)CC2)c1 |
| InChI | InChI=1S/C22H21BrN2O2/c1-2-21(26)24-20-8-3-5-16(13-20)14-22(27)25-11-9-17(10-12-25)18-6-4-7-19(23)15-18/h2-9,13,15H,1,10-12,14H2,(H,24,26) |
| InChIKey | XRJDKHGYKSFTND-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|