C25H35N3O5 — CID 166421636
tert-butyl 2-[acetyl-[1-[2-[3-(prop-2-enoylamino)phenyl]acetyl]azepan-4-yl]amino]acetate (PubChem CID 166421636) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl 2-[acetyl-[1-[2-[3-(prop-2-enoylamino)phenyl]acetyl]azepan-4-yl]amino]acetate.
| Compound Name | tert-butyl 2-[acetyl-[1-[2-[3-(prop-2-enoylamino)phenyl]acetyl]azepan-4-yl]amino]acetate |
|---|---|
| PubChem CID | 166421636 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | tert-butyl 2-[acetyl-[1-[2-[3-(prop-2-enoylamino)phenyl]acetyl]azepan-4-yl]amino]acetate |
| SMILES | C=CC(=O)Nc1cccc(CC(=O)N2CCCC(N(CC(=O)OC(C)(C)C)C(C)=O)CC2)c1 |
| InChI | InChI=1S/C25H35N3O5/c1-6-22(30)26-20-10-7-9-19(15-20)16-23(31)27-13-8-11-21(12-14-27)28(18(2)29)17-24(32)33-25(3,4)5/h6-7,9-10,15,21H,1,8,11-14,16-17H2,2-5H3,(H,26,30) |
| InChIKey | IRMXBFOFWWJGOA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|