C16H18F2N2O3 — CID 166421652
N-[3-[2-[2,2-difluoroethyl(oxetan-3-yl)amino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166421652) has the molecular formula C16H18F2N2O3 and a molecular weight of 324.33 g/mol. Its IUPAC name is N-[3-[2-[2,2-difluoroethyl(oxetan-3-yl)amino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[2,2-difluoroethyl(oxetan-3-yl)amino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421652 |
| Molecular Formula | C16H18F2N2O3 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[3-[2-[2,2-difluoroethyl(oxetan-3-yl)amino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CC(=O)N(CC(F)F)C2COC2)c1 |
| InChI | InChI=1S/C16H18F2N2O3/c1-2-15(21)19-12-5-3-4-11(6-12)7-16(22)20(8-14(17)18)13-9-23-10-13/h2-6,13-14H,1,7-10H2,(H,19,21) |
| InChIKey | IDRVPDWXKTTYRG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|