C21H29N3O3 — CID 166421657
N-propan-2-yl-1-[[2-[3-(prop-2-enoylamino)phenyl]acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 166421657) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-propan-2-yl-1-[[2-[3-(prop-2-enoylamino)phenyl]acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-propan-2-yl-1-[[2-[3-(prop-2-enoylamino)phenyl]acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166421657 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-propan-2-yl-1-[[2-[3-(prop-2-enoylamino)phenyl]acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(CC(=O)NC2(C(=O)NC(C)C)CCCCC2)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-4-18(25)23-17-10-8-9-16(13-17)14-19(26)24-21(11-6-5-7-12-21)20(27)22-15(2)3/h4,8-10,13,15H,1,5-7,11-12,14H2,2-3H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | QYIQNNTWTJXEDU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|