C19H21N3O2S — CID 166421547
N-[3-[2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclobutyl]amino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166421547) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[3-[2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclobutyl]amino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclobutyl]amino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421547 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[3-[2-[[1-(4-methyl-1,3-thiazol-2-yl)cyclobutyl]amino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CC(=O)NC2(c3nc(C)cs3)CCC2)c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-3-16(23)21-15-7-4-6-14(10-15)11-17(24)22-19(8-5-9-19)18-20-13(2)12-25-18/h3-4,6-7,10,12H,1,5,8-9,11H2,2H3,(H,21,23)(H,22,24) |
| InChIKey | RJJKBBRTGHSNKV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|