C21H31N3O4 — CID 38583979
tert-butyl 4-[[3-[[acetyl(methyl)amino]methyl]phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 38583979) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl 4-[[3-[[acetyl(methyl)amino]methyl]phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[[acetyl(methyl)amino]methyl]phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 38583979 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl 4-[[3-[[acetyl(methyl)amino]methyl]phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(=O)N(C)Cc1cccc(NC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H31N3O4/c1-15(25)23(5)14-16-7-6-8-18(13-16)22-19(26)17-9-11-24(12-10-17)20(27)28-21(2,3)4/h6-8,13,17H,9-12,14H2,1-5H3,(H,22,26) |
| InChIKey | ZVSIATLXGQTMKE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |