C21H31N3O4 — CID 166182825
tert-butyl 4-[[[2-(3-ethylanilino)-2-oxoacetyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 166182825) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl 4-[[[2-(3-ethylanilino)-2-oxoacetyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[2-(3-ethylanilino)-2-oxoacetyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166182825 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl 4-[[[2-(3-ethylanilino)-2-oxoacetyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCc1cccc(NC(=O)C(=O)NCC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H31N3O4/c1-5-15-7-6-8-17(13-15)23-19(26)18(25)22-14-16-9-11-24(12-10-16)20(27)28-21(2,3)4/h6-8,13,16H,5,9-12,14H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | WWVNJJCHWPMESL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|