C22H39N3O2 — CID 143307618
tert-butyl 4-[3-[[ethyl(methyl)amino]methyl]anilino]piperidine-1-carboxylate;ethane (PubChem CID 143307618) has the molecular formula C22H39N3O2 and a molecular weight of 377.57 g/mol. Its IUPAC name is tert-butyl 4-[3-[[ethyl(methyl)amino]methyl]anilino]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[3-[[ethyl(methyl)amino]methyl]anilino]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143307618 |
| Molecular Formula | C22H39N3O2 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.30 |
| IUPAC Name | tert-butyl 4-[3-[[ethyl(methyl)amino]methyl]anilino]piperidine-1-carboxylate;ethane |
| SMILES | CC.CCN(C)Cc1cccc(NC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H33N3O2.C2H6/c1-6-22(5)15-16-8-7-9-18(14-16)21-17-10-12-23(13-11-17)19(24)25-20(2,3)4;1-2/h7-9,14,17,21H,6,10-13,15H2,1-5H3;1-2H3 |
| InChIKey | XMQIGFQPPPYDAA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |