C20H33N3O2 — CID 113256335
tert-butyl N-[3-[3-(diethylaminomethyl)anilino]cyclobutyl]carbamate (PubChem CID 113256335) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(diethylaminomethyl)anilino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(diethylaminomethyl)anilino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 113256335 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | tert-butyl N-[3-[3-(diethylaminomethyl)anilino]cyclobutyl]carbamate |
| SMILES | CCN(CC)Cc1cccc(NC2CC(NC(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C20H33N3O2/c1-6-23(7-2)14-15-9-8-10-16(11-15)21-17-12-18(13-17)22-19(24)25-20(3,4)5/h8-11,17-18,21H,6-7,12-14H2,1-5H3,(H,22,24) |
| InChIKey | OTHTZWJVXXJQCL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |