C17H22Cl2N2O3 — CID 78866397
tert-butyl N-[[3-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 78866397) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is tert-butyl N-[[3-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 78866397 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl N-[[3-[(2,2-dichlorocyclopropanecarbonyl)amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cccc(NC(=O)C2CC2(Cl)Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-16(2,3)24-15(23)21(4)10-11-6-5-7-12(8-11)20-14(22)13-9-17(13,18)19/h5-8,13H,9-10H2,1-4H3,(H,20,22) |
| InChIKey | FQFDRNCIQCUTSL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|