C22H26N2O3 — CID 166421645
N-[3-[2-[[3-(2,4-dimethylphenyl)-2-hydroxypropyl]amino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166421645) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[3-[2-[[3-(2,4-dimethylphenyl)-2-hydroxypropyl]amino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[[3-(2,4-dimethylphenyl)-2-hydroxypropyl]amino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421645 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[3-[2-[[3-(2,4-dimethylphenyl)-2-hydroxypropyl]amino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CC(=O)NCC(O)Cc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-4-21(26)24-19-7-5-6-17(11-19)12-22(27)23-14-20(25)13-18-9-8-15(2)10-16(18)3/h4-11,20,25H,1,12-14H2,2-3H3,(H,23,27)(H,24,26) |
| InChIKey | FWLKUCMZLINNDH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|