C16H22ClNO4S2 — CID 166422639
3-[2-[[2-(4-chlorophenoxy)-3-methylbutanoyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422639) has the molecular formula C16H22ClNO4S2 and a molecular weight of 391.94 g/mol. Its IUPAC name is 3-[2-[[2-(4-chlorophenoxy)-3-methylbutanoyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-(4-chlorophenoxy)-3-methylbutanoyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422639 |
| Molecular Formula | C16H22ClNO4S2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 3-[2-[[2-(4-chlorophenoxy)-3-methylbutanoyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(C)C(Oc1ccc(Cl)cc1)C(=O)NCCSSCCC(=O)O |
| InChI | InChI=1S/C16H22ClNO4S2/c1-11(2)15(22-13-5-3-12(17)4-6-13)16(21)18-8-10-24-23-9-7-14(19)20/h3-6,11,15H,7-10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | UCHWRYNDRINYMT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|